C7H7ClF6O2 — CID 58969675
4-chloro-4,5-dimethyl-2,2-bis(trifluoromethyl)-1,3-dioxolane (PubChem CID 58969675) has the molecular formula C7H7ClF6O2 and a molecular weight of 272.57 g/mol. Its IUPAC name is 4-chloro-4,5-dimethyl-2,2-bis(trifluoromethyl)-1,3-dioxolane.
| Compound Name | 4-chloro-4,5-dimethyl-2,2-bis(trifluoromethyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 58969675 |
| Molecular Formula | C7H7ClF6O2 |
| Molecular Weight | 272.57 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | 4-chloro-4,5-dimethyl-2,2-bis(trifluoromethyl)-1,3-dioxolane |
| SMILES | CC1OC(C(F)(F)F)(C(F)(F)F)OC1(C)Cl |
| InChI | InChI=1S/C7H7ClF6O2/c1-3-4(2,8)16-5(15-3,6(9,10)11)7(12,13)14/h3H,1-2H3 |
| InChIKey | MNMGEQJQXBBPKC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.57 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|