About 6-butan-2-yloxy-2,5-dimethyl-4-oxaspiro[2.3]hexane
6-butan-2-yloxy-2,5-dimethyl-4-oxaspiro[2.3]hexane (PubChem CID 58969676) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is 6-butan-2-yloxy-2,5-dimethyl-4-oxaspiro[2.3]hexane.
Molecular Properties
| Compound Name | 6-butan-2-yloxy-2,5-dimethyl-4-oxaspiro[2.3]hexane |
| PubChem CID | 58969676 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 6-butan-2-yloxy-2,5-dimethyl-4-oxaspiro[2.3]hexane |
| SMILES | CCC(C)OC1C(C)OC12CC2C |
| InChI | InChI=1S/C11H20O2/c1-5-8(3)12-10-9(4)13-11(10)6-7(11)2/h7-10H,5-6H2,1-4H3 |
| InChIKey | KYFHCVVVQKUVFS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-butan-2-yloxy-2,5-dimethyl-4-oxaspiro[2.3]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butan-2-yloxy-2,5-dimethyl-4-oxaspiro[2.3]hexane?
The IUPAC name of 6-butan-2-yloxy-2,5-dimethyl-4-oxaspiro[2.3]hexane (CID 58969676) is 6-butan-2-yloxy-2,5-dimethyl-4-oxaspiro[2.3]hexane.
What is the SMILES notation for 6-butan-2-yloxy-2,5-dimethyl-4-oxaspiro[2.3]hexane?
The canonical SMILES for 6-butan-2-yloxy-2,5-dimethyl-4-oxaspiro[2.3]hexane is CCC(C)OC1C(C)OC12CC2C.
What is the InChIKey of 6-butan-2-yloxy-2,5-dimethyl-4-oxaspiro[2.3]hexane?
The InChIKey is KYFHCVVVQKUVFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-5-8(3)12-10-9(4)13-11(10)6-7(11)2/h7-10H,5-6H2,1-4H3.
What are the key properties of 6-butan-2-yloxy-2,5-dimethyl-4-oxaspiro[2.3]hexane?
6-butan-2-yloxy-2,5-dimethyl-4-oxaspiro[2.3]hexane has a molecular weight of 184.28 g/mol, XLogP of 2.37, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butan-2-yloxy-2,5-dimethyl-4-oxaspiro[2.3]hexane is sourced from PubChem (CID 58969676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).