About (3,4-dihydroxy-1-adamantyl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate
(3,4-dihydroxy-1-adamantyl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate (PubChem CID 58969747) has the molecular formula C12H16F2O7S
and a molecular weight of 342.32 g/mol. Its IUPAC name is (3,4-dihydroxy-1-adamantyl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate.
Molecular Properties
| Compound Name | (3,4-dihydroxy-1-adamantyl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate |
| PubChem CID | 58969747 |
| Molecular Formula | C12H16F2O7S |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | (3,4-dihydroxy-1-adamantyl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate |
| SMILES | O=C(OC12CC3CC(C1)C(O)C(O)(C3)C2)C(F)(F)SOOO |
| InChI | InChI=1S/C12H16F2O7S/c13-12(14,22-21-20-18)9(16)19-10-2-6-1-7(4-10)8(15)11(17,3-6)5-10/h6-8,15,17-18H,1-5H2 |
| InChIKey | DNSKCDHMZVQHDQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3,4-dihydroxy-1-adamantyl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dihydroxy-1-adamantyl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate?
The IUPAC name of (3,4-dihydroxy-1-adamantyl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate (CID 58969747) is (3,4-dihydroxy-1-adamantyl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate.
What is the SMILES notation for (3,4-dihydroxy-1-adamantyl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate?
The canonical SMILES for (3,4-dihydroxy-1-adamantyl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate is O=C(OC12CC3CC(C1)C(O)C(O)(C3)C2)C(F)(F)SOOO.
What is the InChIKey of (3,4-dihydroxy-1-adamantyl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate?
The InChIKey is DNSKCDHMZVQHDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2O7S/c13-12(14,22-21-20-18)9(16)19-10-2-6-1-7(4-10)8(15)11(17,3-6)5-10/h6-8,15,17-18H,1-5H2.
What are the key properties of (3,4-dihydroxy-1-adamantyl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate?
(3,4-dihydroxy-1-adamantyl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate has a molecular weight of 342.32 g/mol, XLogP of 1.25, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dihydroxy-1-adamantyl) 2,2-difluoro-2-(trioxidanylsulfanyl)acetate is sourced from PubChem (CID 58969747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).