About 3-methyl-6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one
3-methyl-6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one (PubChem CID 58970104) has the molecular formula C7H9N3O
and a molecular weight of 151.17 g/mol. Its IUPAC name is 3-methyl-6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one.
Molecular Properties
| Compound Name | 3-methyl-6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one |
| PubChem CID | 58970104 |
| Molecular Formula | C7H9N3O |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | 3-methyl-6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one |
| SMILES | Cc1ncc2n1CCNC2=O |
| InChI | InChI=1S/C7H9N3O/c1-5-9-4-6-7(11)8-2-3-10(5)6/h4H,2-3H2,1H3,(H,8,11) |
| InChIKey | DAIFDOQXXYPIFM-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one?
The IUPAC name of 3-methyl-6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one (CID 58970104) is 3-methyl-6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one.
What is the SMILES notation for 3-methyl-6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one?
The canonical SMILES for 3-methyl-6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one is Cc1ncc2n1CCNC2=O.
What is the InChIKey of 3-methyl-6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one?
The InChIKey is DAIFDOQXXYPIFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O/c1-5-9-4-6-7(11)8-2-3-10(5)6/h4H,2-3H2,1H3,(H,8,11).
What are the key properties of 3-methyl-6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one?
3-methyl-6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one has a molecular weight of 151.17 g/mol, XLogP of -0.07, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-6,7-dihydro-5H-imidazo[1,5-a]pyrazin-8-one is sourced from PubChem (CID 58970104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).