About N-methyl-2-pyrrolo[3,2-b]pyridin-1-ylethanamine
N-methyl-2-pyrrolo[3,2-b]pyridin-1-ylethanamine (PubChem CID 58970231) has the molecular formula C10H13N3
and a molecular weight of 175.23 g/mol. Its IUPAC name is N-methyl-2-pyrrolo[3,2-b]pyridin-1-ylethanamine.
Molecular Properties
| Compound Name | N-methyl-2-pyrrolo[3,2-b]pyridin-1-ylethanamine |
| PubChem CID | 58970231 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | N-methyl-2-pyrrolo[3,2-b]pyridin-1-ylethanamine |
| SMILES | CNCCn1ccc2ncccc21 |
| InChI | InChI=1S/C10H13N3/c1-11-6-8-13-7-4-9-10(13)3-2-5-12-9/h2-5,7,11H,6,8H2,1H3 |
| InChIKey | LPGVWNZTFYBYHY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-2-pyrrolo[3,2-b]pyridin-1-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-pyrrolo[3,2-b]pyridin-1-ylethanamine?
The IUPAC name of N-methyl-2-pyrrolo[3,2-b]pyridin-1-ylethanamine (CID 58970231) is N-methyl-2-pyrrolo[3,2-b]pyridin-1-ylethanamine.
What is the SMILES notation for N-methyl-2-pyrrolo[3,2-b]pyridin-1-ylethanamine?
The canonical SMILES for N-methyl-2-pyrrolo[3,2-b]pyridin-1-ylethanamine is CNCCn1ccc2ncccc21.
What is the InChIKey of N-methyl-2-pyrrolo[3,2-b]pyridin-1-ylethanamine?
The InChIKey is LPGVWNZTFYBYHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-11-6-8-13-7-4-9-10(13)3-2-5-12-9/h2-5,7,11H,6,8H2,1H3.
What are the key properties of N-methyl-2-pyrrolo[3,2-b]pyridin-1-ylethanamine?
N-methyl-2-pyrrolo[3,2-b]pyridin-1-ylethanamine has a molecular weight of 175.23 g/mol, XLogP of 1.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-pyrrolo[3,2-b]pyridin-1-ylethanamine is sourced from PubChem (CID 58970231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).