C17H18F3N3O2 — CID 58970303
3-[(5-ethylpyrimidin-2-yl)-[[4-(trifluoromethoxy)phenyl]methyl]amino]propanal (PubChem CID 58970303) has the molecular formula C17H18F3N3O2 and a molecular weight of 353.34 g/mol. Its IUPAC name is 3-[(5-ethylpyrimidin-2-yl)-[[4-(trifluoromethoxy)phenyl]methyl]amino]propanal.
| Compound Name | 3-[(5-ethylpyrimidin-2-yl)-[[4-(trifluoromethoxy)phenyl]methyl]amino]propanal |
|---|---|
| PubChem CID | 58970303 |
| Molecular Formula | C17H18F3N3O2 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 3-[(5-ethylpyrimidin-2-yl)-[[4-(trifluoromethoxy)phenyl]methyl]amino]propanal |
| SMILES | CCc1cnc(N(CCC=O)Cc2ccc(OC(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C17H18F3N3O2/c1-2-13-10-21-16(22-11-13)23(8-3-9-24)12-14-4-6-15(7-5-14)25-17(18,19)20/h4-7,9-11H,2-3,8,12H2,1H3 |
| InChIKey | BRWFWVULAGIBBN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|