About N,N-dimethyl-3-(2-methylpropyl)-1,2,4-thiadiazol-5-amine
N,N-dimethyl-3-(2-methylpropyl)-1,2,4-thiadiazol-5-amine (PubChem CID 58970590) has the molecular formula C8H15N3S
and a molecular weight of 185.30 g/mol. Its IUPAC name is N,N-dimethyl-3-(2-methylpropyl)-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | N,N-dimethyl-3-(2-methylpropyl)-1,2,4-thiadiazol-5-amine |
| PubChem CID | 58970590 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | N,N-dimethyl-3-(2-methylpropyl)-1,2,4-thiadiazol-5-amine |
| SMILES | CC(C)Cc1nsc(N(C)C)n1 |
| InChI | InChI=1S/C8H15N3S/c1-6(2)5-7-9-8(11(3)4)12-10-7/h6H,5H2,1-4H3 |
| InChIKey | TZZDIAVDAMIDOC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dimethyl-3-(2-methylpropyl)-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-3-(2-methylpropyl)-1,2,4-thiadiazol-5-amine?
The IUPAC name of N,N-dimethyl-3-(2-methylpropyl)-1,2,4-thiadiazol-5-amine (CID 58970590) is N,N-dimethyl-3-(2-methylpropyl)-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for N,N-dimethyl-3-(2-methylpropyl)-1,2,4-thiadiazol-5-amine?
The canonical SMILES for N,N-dimethyl-3-(2-methylpropyl)-1,2,4-thiadiazol-5-amine is CC(C)Cc1nsc(N(C)C)n1.
What is the InChIKey of N,N-dimethyl-3-(2-methylpropyl)-1,2,4-thiadiazol-5-amine?
The InChIKey is TZZDIAVDAMIDOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3S/c1-6(2)5-7-9-8(11(3)4)12-10-7/h6H,5H2,1-4H3.
What are the key properties of N,N-dimethyl-3-(2-methylpropyl)-1,2,4-thiadiazol-5-amine?
N,N-dimethyl-3-(2-methylpropyl)-1,2,4-thiadiazol-5-amine has a molecular weight of 185.30 g/mol, XLogP of 1.80, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-3-(2-methylpropyl)-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 58970590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).