About 2,3-dimethyl-3-propan-2-yl-1,2-dihydroindole
2,3-dimethyl-3-propan-2-yl-1,2-dihydroindole (PubChem CID 589709) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is 2,3-dimethyl-3-propan-2-yl-1,2-dihydroindole.
Molecular Properties
| Compound Name | 2,3-dimethyl-3-propan-2-yl-1,2-dihydroindole |
| PubChem CID | 589709 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 2,3-dimethyl-3-propan-2-yl-1,2-dihydroindole |
| SMILES | CC(C)C1(C)c2ccccc2NC1C |
| InChI | InChI=1S/C13H19N/c1-9(2)13(4)10(3)14-12-8-6-5-7-11(12)13/h5-10,14H,1-4H3 |
| InChIKey | QGBKERMPJRWFBZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dimethyl-3-propan-2-yl-1,2-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-3-propan-2-yl-1,2-dihydroindole?
The IUPAC name of 2,3-dimethyl-3-propan-2-yl-1,2-dihydroindole (CID 589709) is 2,3-dimethyl-3-propan-2-yl-1,2-dihydroindole.
What is the SMILES notation for 2,3-dimethyl-3-propan-2-yl-1,2-dihydroindole?
The canonical SMILES for 2,3-dimethyl-3-propan-2-yl-1,2-dihydroindole is CC(C)C1(C)c2ccccc2NC1C.
What is the InChIKey of 2,3-dimethyl-3-propan-2-yl-1,2-dihydroindole?
The InChIKey is QGBKERMPJRWFBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N/c1-9(2)13(4)10(3)14-12-8-6-5-7-11(12)13/h5-10,14H,1-4H3.
What are the key properties of 2,3-dimethyl-3-propan-2-yl-1,2-dihydroindole?
2,3-dimethyl-3-propan-2-yl-1,2-dihydroindole has a molecular weight of 189.30 g/mol, XLogP of 3.41, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-3-propan-2-yl-1,2-dihydroindole is sourced from PubChem (CID 589709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).