C14H21NO2 — CID 58971065
(1R,3S,3aS,6R,7aS)-3-hydroxy-3a-methyl-4-oxo-6-propan-2-yl-2,3,5,6,7,7a-hexahydro-1H-indene-1-carbonitrile (PubChem CID 58971065) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is (1R,3S,3aS,6R,7aS)-3-hydroxy-3a-methyl-4-oxo-6-propan-2-yl-2,3,5,6,7,7a-hexahydro-1H-indene-1-carbonitrile.
| Compound Name | (1R,3S,3aS,6R,7aS)-3-hydroxy-3a-methyl-4-oxo-6-propan-2-yl-2,3,5,6,7,7a-hexahydro-1H-indene-1-carbonitrile |
|---|---|
| PubChem CID | 58971065 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | (1R,3S,3aS,6R,7aS)-3-hydroxy-3a-methyl-4-oxo-6-propan-2-yl-2,3,5,6,7,7a-hexahydro-1H-indene-1-carbonitrile |
| SMILES | CC(C)[C@H]1CC(=O)[C@]2(C)[C@@H](O)C[C@@H](C#N)[C@@H]2C1 |
| InChI | InChI=1S/C14H21NO2/c1-8(2)9-4-11-10(7-15)6-13(17)14(11,3)12(16)5-9/h8-11,13,17H,4-6H2,1-3H3/t9-,10+,11+,13+,14-/m1/s1 |
| InChIKey | QKQHZFYMQKVSSW-VSEIDBEKSA-N |
| XLogP | 2.15 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |