C18H28O7 — CID 58971253
(1S,2R,3R,4S,6S,7S,9S,13S,16R)-4,7,16-trihydroxy-3,7,11,11,13-pentamethyl-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecan-14-one (PubChem CID 58971253) has the molecular formula C18H28O7 and a molecular weight of 356.42 g/mol. Its IUPAC name is (1S,2R,3R,4S,6S,7S,9S,13S,16R)-4,7,16-trihydroxy-3,7,11,11,13-pentamethyl-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecan-14-one.
| Compound Name | (1S,2R,3R,4S,6S,7S,9S,13S,16R)-4,7,16-trihydroxy-3,7,11,11,13-pentamethyl-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecan-14-one |
|---|---|
| PubChem CID | 58971253 |
| Molecular Formula | C18H28O7 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (1S,2R,3R,4S,6S,7S,9S,13S,16R)-4,7,16-trihydroxy-3,7,11,11,13-pentamethyl-10,12,15-trioxatetracyclo[7.6.1.02,6.013,16]hexadecan-14-one |
| SMILES | C[C@@H]1[C@H]2[C@@H]3OC(=O)[C@@]4(C)OC(C)(C)O[C@@H](C[C@](C)(O)[C@H]2C[C@@H]1O)[C@@]34O |
| InChI | InChI=1S/C18H28O7/c1-8-10(19)6-9-12(8)13-18(22)11(7-16(9,4)21)24-15(2,3)25-17(18,5)14(20)23-13/h8-13,19,21-22H,6-7H2,1-5H3/t8-,9-,10-,11-,12+,13-,16-,17+,18+/m0/s1 |
| InChIKey | DBPXXRLHCUOQKL-XVZUNPEHSA-N |
| XLogP | 0.34 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |