C24H30F16O4 — CID 58971607
3-(1,1-difluoroethyl)-1-[2-[[3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluoro-1-(trifluoromethyl)cyclopentyl]oxymethoxy]ethoxymethoxy]-4-ethyl-2,2,3-trifluoro-1-(trifluoromethyl)cyclopentane (PubChem CID 58971607) has the molecular formula C24H30F16O4 and a molecular weight of 686.47 g/mol. Its IUPAC name is 3-(1,1-difluoroethyl)-1-[2-[[3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluoro-1-(trifluoromethyl)cyclopentyl]oxymethoxy]ethoxymethoxy]-4-ethyl-2,2,3-trifluoro-1-(trifluoromethyl)cyclopentane.
| Compound Name | 3-(1,1-difluoroethyl)-1-[2-[[3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluoro-1-(trifluoromethyl)cyclopentyl]oxymethoxy]ethoxymethoxy]-4-ethyl-2,2,3-trifluoro-1-(trifluoromethyl)cyclopentane |
|---|---|
| PubChem CID | 58971607 |
| Molecular Formula | C24H30F16O4 |
| Molecular Weight | 686.47 g/mol |
| Exact Mass | 686.19 |
| IUPAC Name | 3-(1,1-difluoroethyl)-1-[2-[[3-(1,1-difluoroethyl)-4-ethyl-2,2,3-trifluoro-1-(trifluoromethyl)cyclopentyl]oxymethoxy]ethoxymethoxy]-4-ethyl-2,2,3-trifluoro-1-(trifluoromethyl)cyclopentane |
| SMILES | CCC1CC(OCOCCOCOC2(C(F)(F)F)CC(CC)C(F)(C(C)(F)F)C2(F)F)(C(F)(F)F)C(F)(F)C1(F)C(C)(F)F |
| InChI | InChI=1S/C24H30F16O4/c1-5-13-9-17(23(35,36)37,21(31,32)19(13,29)15(3,25)26)43-11-41-7-8-42-12-44-18(24(38,39)40)10-14(6-2)20(30,16(4,27)28)22(18,33)34/h13-14H,5-12H2,1-4H3 |
| InChIKey | BTLSALCJZLIAEY-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.47 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|