C15H17N3O2S2 — CID 58971888
5-(2,3-dihydro-1,3-benzothiazol-2-yl)-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 58971888) has the molecular formula C15H17N3O2S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 5-(2,3-dihydro-1,3-benzothiazol-2-yl)-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-(2,3-dihydro-1,3-benzothiazol-2-yl)-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 58971888 |
| Molecular Formula | C15H17N3O2S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 5-(2,3-dihydro-1,3-benzothiazol-2-yl)-1,3-diethyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | CCN1C(=O)C(C2Nc3ccccc3S2)C(=O)N(CC)C1=S |
| InChI | InChI=1S/C15H17N3O2S2/c1-3-17-13(19)11(14(20)18(4-2)15(17)21)12-16-9-7-5-6-8-10(9)22-12/h5-8,11-12,16H,3-4H2,1-2H3 |
| InChIKey | HVJRFGQWVZLCNO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|