About 3,3-dimethyl-2,4-dioxabicyclo[3.2.1]oct-6-ene
3,3-dimethyl-2,4-dioxabicyclo[3.2.1]oct-6-ene (PubChem CID 58971980) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is 3,3-dimethyl-2,4-dioxabicyclo[3.2.1]oct-6-ene.
Molecular Properties
| Compound Name | 3,3-dimethyl-2,4-dioxabicyclo[3.2.1]oct-6-ene |
| PubChem CID | 58971980 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 3,3-dimethyl-2,4-dioxabicyclo[3.2.1]oct-6-ene |
| SMILES | CC1(C)OC2C=CC(C2)O1 |
| InChI | InChI=1S/C8H12O2/c1-8(2)9-6-3-4-7(5-6)10-8/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | VSGYWFIZBCVSKH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyl-2,4-dioxabicyclo[3.2.1]oct-6-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-2,4-dioxabicyclo[3.2.1]oct-6-ene?
The IUPAC name of 3,3-dimethyl-2,4-dioxabicyclo[3.2.1]oct-6-ene (CID 58971980) is 3,3-dimethyl-2,4-dioxabicyclo[3.2.1]oct-6-ene.
What is the SMILES notation for 3,3-dimethyl-2,4-dioxabicyclo[3.2.1]oct-6-ene?
The canonical SMILES for 3,3-dimethyl-2,4-dioxabicyclo[3.2.1]oct-6-ene is CC1(C)OC2C=CC(C2)O1.
What is the InChIKey of 3,3-dimethyl-2,4-dioxabicyclo[3.2.1]oct-6-ene?
The InChIKey is VSGYWFIZBCVSKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c1-8(2)9-6-3-4-7(5-6)10-8/h3-4,6-7H,5H2,1-2H3.
What are the key properties of 3,3-dimethyl-2,4-dioxabicyclo[3.2.1]oct-6-ene?
3,3-dimethyl-2,4-dioxabicyclo[3.2.1]oct-6-ene has a molecular weight of 140.18 g/mol, XLogP of 1.47, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-2,4-dioxabicyclo[3.2.1]oct-6-ene is sourced from PubChem (CID 58971980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).