About CID 58972016
CID 58972016 (PubChem CID 58972016) has the molecular formula C7H10BFO3
and a molecular weight of 171.96 g/mol.
Molecular Properties
| Compound Name | CID 58972016 |
| PubChem CID | 58972016 |
| Molecular Formula | C7H10BFO3 |
| Molecular Weight | 171.96 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | — |
| SMILES | [B]C1CC(CC(=O)O)C(O)C1F |
| InChI | InChI=1S/C7H10BFO3/c8-4-1-3(2-5(10)11)7(12)6(4)9/h3-4,6-7,12H,1-2H2,(H,10,11) |
| InChIKey | HIPPLXSEZLFUSP-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.96 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 58972016 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58972016?
The IUPAC name of CID 58972016 (CID 58972016) is not available.
What is the SMILES notation for CID 58972016?
The canonical SMILES for CID 58972016 is [B]C1CC(CC(=O)O)C(O)C1F.
What is the InChIKey of CID 58972016?
The InChIKey is HIPPLXSEZLFUSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10BFO3/c8-4-1-3(2-5(10)11)7(12)6(4)9/h3-4,6-7,12H,1-2H2,(H,10,11).
What are the key properties of CID 58972016?
CID 58972016 has a molecular weight of 171.96 g/mol, XLogP of 0.14, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58972016 is sourced from PubChem (CID 58972016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).