C29H37FO — CID 58972037
(13R,17R)-2-ethyl-17-(2-fluoroethyl)-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 58972037) has the molecular formula C29H37FO and a molecular weight of 420.61 g/mol. Its IUPAC name is (13R,17R)-2-ethyl-17-(2-fluoroethyl)-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (13R,17R)-2-ethyl-17-(2-fluoroethyl)-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 58972037 |
| Molecular Formula | C29H37FO |
| Molecular Weight | 420.61 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | (13R,17R)-2-ethyl-17-(2-fluoroethyl)-13-methyl-3-phenylmethoxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | CCc1cc2c(cc1OCc1ccccc1)CCC1C2CC[C@@]2(C)C1CC[C@@H]2CCF |
| InChI | InChI=1S/C29H37FO/c1-3-21-17-26-22(18-28(21)31-19-20-7-5-4-6-8-20)9-11-25-24(26)13-15-29(2)23(14-16-30)10-12-27(25)29/h4-8,17-18,23-25,27H,3,9-16,19H2,1-2H3/t23-,24?,25?,27?,29-/m1/s1 |
| InChIKey | JZDUBLGDBGXPCL-RQCMIIIZSA-N |
| XLogP | 7.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.61 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |