About [5-(2-amino-5-benzoyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid
[5-(2-amino-5-benzoyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid (PubChem CID 58972099) has the molecular formula C14H11N2O5PS
and a molecular weight of 350.29 g/mol. Its IUPAC name is [5-(2-amino-5-benzoyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid.
Molecular Properties
| Compound Name | [5-(2-amino-5-benzoyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid |
| PubChem CID | 58972099 |
| Molecular Formula | C14H11N2O5PS |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | [5-(2-amino-5-benzoyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid |
| SMILES | Nc1nc(-c2ccc(P(=O)(O)O)o2)c(C(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C14H11N2O5PS/c15-14-16-11(9-6-7-10(21-9)22(18,19)20)13(23-14)12(17)8-4-2-1-3-5-8/h1-7H,(H2,15,16)(H2,18,19,20) |
| InChIKey | AFHPGRNNXXBBMS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [5-(2-amino-5-benzoyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-amino-5-benzoyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid?
The IUPAC name of [5-(2-amino-5-benzoyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid (CID 58972099) is [5-(2-amino-5-benzoyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid.
What is the SMILES notation for [5-(2-amino-5-benzoyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid?
The canonical SMILES for [5-(2-amino-5-benzoyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid is Nc1nc(-c2ccc(P(=O)(O)O)o2)c(C(=O)c2ccccc2)s1.
What is the InChIKey of [5-(2-amino-5-benzoyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid?
The InChIKey is AFHPGRNNXXBBMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N2O5PS/c15-14-16-11(9-6-7-10(21-9)22(18,19)20)13(23-14)12(17)8-4-2-1-3-5-8/h1-7H,(H2,15,16)(H2,18,19,20).
What are the key properties of [5-(2-amino-5-benzoyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid?
[5-(2-amino-5-benzoyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid has a molecular weight of 350.29 g/mol, XLogP of 2.02, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-amino-5-benzoyl-1,3-thiazol-4-yl)furan-2-yl]phosphonic acid is sourced from PubChem (CID 58972099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).