C14H17N5O2 — CID 58972457
6-N-piperidin-4-yl-[1,3]dioxolo[4,5-g]quinazoline-6,8-diamine (PubChem CID 58972457) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is 6-N-piperidin-4-yl-[1,3]dioxolo[4,5-g]quinazoline-6,8-diamine.
| Compound Name | 6-N-piperidin-4-yl-[1,3]dioxolo[4,5-g]quinazoline-6,8-diamine |
|---|---|
| PubChem CID | 58972457 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 6-N-piperidin-4-yl-[1,3]dioxolo[4,5-g]quinazoline-6,8-diamine |
| SMILES | Nc1nc(NC2CCNCC2)nc2cc3c(cc12)OCO3 |
| InChI | InChI=1S/C14H17N5O2/c15-13-9-5-11-12(21-7-20-11)6-10(9)18-14(19-13)17-8-1-3-16-4-2-8/h5-6,8,16H,1-4,7H2,(H3,15,17,18,19) |
| InChIKey | RCGGKCIIFSGFMY-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |