C28H35F3N6O — CID 58972598
4-N-(4-tert-butylphenyl)-2-N-(2-methoxyethyl)-2-N-methyl-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 58972598) has the molecular formula C28H35F3N6O and a molecular weight of 528.62 g/mol. Its IUPAC name is 4-N-(4-tert-butylphenyl)-2-N-(2-methoxyethyl)-2-N-methyl-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 4-N-(4-tert-butylphenyl)-2-N-(2-methoxyethyl)-2-N-methyl-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 58972598 |
| Molecular Formula | C28H35F3N6O |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | 4-N-(4-tert-butylphenyl)-2-N-(2-methoxyethyl)-2-N-methyl-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | COCCN(C)c1nc2c(c(Nc3ccc(C(C)(C)C)cc3)n1)CCN(c1ncccc1C(F)(F)F)CC2 |
| InChI | InChI=1S/C28H35F3N6O/c1-27(2,3)19-8-10-20(11-9-19)33-24-21-12-15-37(25-22(28(29,30)31)7-6-14-32-25)16-13-23(21)34-26(35-24)36(4)17-18-38-5/h6-11,14H,12-13,15-18H2,1-5H3,(H,33,34,35) |
| InChIKey | SMUOBGZHPRFINI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |