C32H33F3N6S — CID 58972677
2-phenylsulfanyl-7-[3-(trifluoromethyl)-2-pyridinyl]-N-(1,4,4-trimethyl-2,3-dihydroquinolin-7-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine (PubChem CID 58972677) has the molecular formula C32H33F3N6S and a molecular weight of 590.72 g/mol. Its IUPAC name is 2-phenylsulfanyl-7-[3-(trifluoromethyl)-2-pyridinyl]-N-(1,4,4-trimethyl-2,3-dihydroquinolin-7-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine.
| Compound Name | 2-phenylsulfanyl-7-[3-(trifluoromethyl)-2-pyridinyl]-N-(1,4,4-trimethyl-2,3-dihydroquinolin-7-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine |
|---|---|
| PubChem CID | 58972677 |
| Molecular Formula | C32H33F3N6S |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | 2-phenylsulfanyl-7-[3-(trifluoromethyl)-2-pyridinyl]-N-(1,4,4-trimethyl-2,3-dihydroquinolin-7-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine |
| SMILES | CN1CCC(C)(C)c2ccc(Nc3nc(Sc4ccccc4)nc4c3CCN(c3ncccc3C(F)(F)F)CC4)cc21 |
| InChI | InChI=1S/C32H33F3N6S/c1-31(2)15-19-40(3)27-20-21(11-12-24(27)31)37-28-23-13-17-41(29-25(32(33,34)35)10-7-16-36-29)18-14-26(23)38-30(39-28)42-22-8-5-4-6-9-22/h4-12,16,20H,13-15,17-19H2,1-3H3,(H,37,38,39) |
| InChIKey | OCBCQHBSUGOVMB-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |