C22H22ClF3N6 — CID 58972716
4-N-(4-chlorophenyl)-2-N,2-N-dimethyl-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 58972716) has the molecular formula C22H22ClF3N6 and a molecular weight of 462.91 g/mol. Its IUPAC name is 4-N-(4-chlorophenyl)-2-N,2-N-dimethyl-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 4-N-(4-chlorophenyl)-2-N,2-N-dimethyl-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 58972716 |
| Molecular Formula | C22H22ClF3N6 |
| Molecular Weight | 462.91 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 4-N-(4-chlorophenyl)-2-N,2-N-dimethyl-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | CN(C)c1nc2c(c(Nc3ccc(Cl)cc3)n1)CCN(c1ncccc1C(F)(F)F)CC2 |
| InChI | InChI=1S/C22H22ClF3N6/c1-31(2)21-29-18-10-13-32(20-17(22(24,25)26)4-3-11-27-20)12-9-16(18)19(30-21)28-15-7-5-14(23)6-8-15/h3-8,11H,9-10,12-13H2,1-2H3,(H,28,29,30) |
| InChIKey | KVKQYMNHALMEQK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.91 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |