C23H25F3N6O — CID 58972755
4-N-(4-methoxyphenyl)-2-N,2-N-dimethyl-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine (PubChem CID 58972755) has the molecular formula C23H25F3N6O and a molecular weight of 458.49 g/mol. Its IUPAC name is 4-N-(4-methoxyphenyl)-2-N,2-N-dimethyl-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine.
| Compound Name | 4-N-(4-methoxyphenyl)-2-N,2-N-dimethyl-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
|---|---|
| PubChem CID | 58972755 |
| Molecular Formula | C23H25F3N6O |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 4-N-(4-methoxyphenyl)-2-N,2-N-dimethyl-7-[3-(trifluoromethyl)-2-pyridinyl]-5,6,8,9-tetrahydropyrimido[4,5-d]azepine-2,4-diamine |
| SMILES | COc1ccc(Nc2nc(N(C)C)nc3c2CCN(c2ncccc2C(F)(F)F)CC3)cc1 |
| InChI | InChI=1S/C23H25F3N6O/c1-31(2)22-29-19-11-14-32(21-18(23(24,25)26)5-4-12-27-21)13-10-17(19)20(30-22)28-15-6-8-16(33-3)9-7-15/h4-9,12H,10-11,13-14H2,1-3H3,(H,28,29,30) |
| InChIKey | DNZPWQBMABBTKK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |