About 3-isocyano-2-(1,2,4-triazol-1-yl)pyridine
3-isocyano-2-(1,2,4-triazol-1-yl)pyridine (PubChem CID 58973004) has the molecular formula C8H5N5
and a molecular weight of 171.16 g/mol. Its IUPAC name is 3-isocyano-2-(1,2,4-triazol-1-yl)pyridine.
Molecular Properties
| Compound Name | 3-isocyano-2-(1,2,4-triazol-1-yl)pyridine |
| PubChem CID | 58973004 |
| Molecular Formula | C8H5N5 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.05 |
| IUPAC Name | 3-isocyano-2-(1,2,4-triazol-1-yl)pyridine |
| SMILES | [C-]#[N+]c1cccnc1-n1cncn1 |
| InChI | InChI=1S/C8H5N5/c1-9-7-3-2-4-11-8(7)13-6-10-5-12-13/h2-6H |
| InChIKey | VHYFYNPTZDBMHM-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 47.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-isocyano-2-(1,2,4-triazol-1-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-isocyano-2-(1,2,4-triazol-1-yl)pyridine?
The IUPAC name of 3-isocyano-2-(1,2,4-triazol-1-yl)pyridine (CID 58973004) is 3-isocyano-2-(1,2,4-triazol-1-yl)pyridine.
What is the SMILES notation for 3-isocyano-2-(1,2,4-triazol-1-yl)pyridine?
The canonical SMILES for 3-isocyano-2-(1,2,4-triazol-1-yl)pyridine is [C-]#[N+]c1cccnc1-n1cncn1.
What is the InChIKey of 3-isocyano-2-(1,2,4-triazol-1-yl)pyridine?
The InChIKey is VHYFYNPTZDBMHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N5/c1-9-7-3-2-4-11-8(7)13-6-10-5-12-13/h2-6H.
What are the key properties of 3-isocyano-2-(1,2,4-triazol-1-yl)pyridine?
3-isocyano-2-(1,2,4-triazol-1-yl)pyridine has a molecular weight of 171.16 g/mol, XLogP of 1.21, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-isocyano-2-(1,2,4-triazol-1-yl)pyridine is sourced from PubChem (CID 58973004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).