About 1,3-di(piperidin-4-yl)urea
1,3-di(piperidin-4-yl)urea (PubChem CID 58973009) has the molecular formula C11H22N4O
and a molecular weight of 226.32 g/mol. Its IUPAC name is 1,3-di(piperidin-4-yl)urea.
Molecular Properties
| Compound Name | 1,3-di(piperidin-4-yl)urea |
| PubChem CID | 58973009 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 1,3-di(piperidin-4-yl)urea |
| SMILES | O=C(NC1CCNCC1)NC1CCNCC1 |
| InChI | InChI=1S/C11H22N4O/c16-11(14-9-1-5-12-6-2-9)15-10-3-7-13-8-4-10/h9-10,12-13H,1-8H2,(H2,14,15,16) |
| InChIKey | AEGYWLZLEJYWCI-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-di(piperidin-4-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-di(piperidin-4-yl)urea?
The IUPAC name of 1,3-di(piperidin-4-yl)urea (CID 58973009) is 1,3-di(piperidin-4-yl)urea.
What is the SMILES notation for 1,3-di(piperidin-4-yl)urea?
The canonical SMILES for 1,3-di(piperidin-4-yl)urea is O=C(NC1CCNCC1)NC1CCNCC1.
What is the InChIKey of 1,3-di(piperidin-4-yl)urea?
The InChIKey is AEGYWLZLEJYWCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N4O/c16-11(14-9-1-5-12-6-2-9)15-10-3-7-13-8-4-10/h9-10,12-13H,1-8H2,(H2,14,15,16).
What are the key properties of 1,3-di(piperidin-4-yl)urea?
1,3-di(piperidin-4-yl)urea has a molecular weight of 226.32 g/mol, XLogP of -0.21, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-di(piperidin-4-yl)urea is sourced from PubChem (CID 58973009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).