C14H24N2O3 — CID 58973568
(3S)-N-cyclopropyl-3-(2,2-dimethylpropanoylamino)-2-oxohexanamide (PubChem CID 58973568) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is (3S)-N-cyclopropyl-3-(2,2-dimethylpropanoylamino)-2-oxohexanamide.
| Compound Name | (3S)-N-cyclopropyl-3-(2,2-dimethylpropanoylamino)-2-oxohexanamide |
|---|---|
| PubChem CID | 58973568 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | (3S)-N-cyclopropyl-3-(2,2-dimethylpropanoylamino)-2-oxohexanamide |
| SMILES | CCC[C@H](NC(=O)C(C)(C)C)C(=O)C(=O)NC1CC1 |
| InChI | InChI=1S/C14H24N2O3/c1-5-6-10(16-13(19)14(2,3)4)11(17)12(18)15-9-7-8-9/h9-10H,5-8H2,1-4H3,(H,15,18)(H,16,19)/t10-/m0/s1 |
| InChIKey | JNJBGNJVPLGHHM-JTQLQIEISA-N |
| XLogP | 1.17 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|