About CID 58974129
CID 58974129 (PubChem CID 58974129) has the molecular formula C15H28NO3
and a molecular weight of 270.39 g/mol.
Molecular Properties
| Compound Name | CID 58974129 |
| PubChem CID | 58974129 |
| Molecular Formula | C15H28NO3 |
| Molecular Weight | 270.39 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | — |
| SMILES | CCC1(C)C(C)C2(OCCO2)C(C)C(C)(CC)N1[O] |
| InChI | InChI=1S/C15H28NO3/c1-7-13(5)11(3)15(18-9-10-19-15)12(4)14(6,8-2)16(13)17/h11-12H,7-10H2,1-6H3 |
| InChIKey | SJJFAIDSVXRIPY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 41.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 58974129 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58974129?
The IUPAC name of CID 58974129 (CID 58974129) is not available.
What is the SMILES notation for CID 58974129?
The canonical SMILES for CID 58974129 is CCC1(C)C(C)C2(OCCO2)C(C)C(C)(CC)N1[O].
What is the InChIKey of CID 58974129?
The InChIKey is SJJFAIDSVXRIPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28NO3/c1-7-13(5)11(3)15(18-9-10-19-15)12(4)14(6,8-2)16(13)17/h11-12H,7-10H2,1-6H3.
What are the key properties of CID 58974129?
CID 58974129 has a molecular weight of 270.39 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58974129 is sourced from PubChem (CID 58974129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).