C9H19NO2 — CID 58974334
2-[cyclobutyl(methyl)amino]butane-1,4-diol (PubChem CID 58974334) has the molecular formula C9H19NO2 and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-[cyclobutyl(methyl)amino]butane-1,4-diol.
| Compound Name | 2-[cyclobutyl(methyl)amino]butane-1,4-diol |
|---|---|
| PubChem CID | 58974334 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 2-[cyclobutyl(methyl)amino]butane-1,4-diol |
| SMILES | CN(C(CO)CCO)C1CCC1 |
| InChI | InChI=1S/C9H19NO2/c1-10(8-3-2-4-8)9(7-12)5-6-11/h8-9,11-12H,2-7H2,1H3 |
| InChIKey | QTSMIMAVDRSIJH-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |