C24H22N2O4 — CID 58974470
2-(2-phenylbenzimidazol-1-yl)ethyl 3,5-dimethoxybenzoate (PubChem CID 58974470) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-(2-phenylbenzimidazol-1-yl)ethyl 3,5-dimethoxybenzoate.
| Compound Name | 2-(2-phenylbenzimidazol-1-yl)ethyl 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 58974470 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 2-(2-phenylbenzimidazol-1-yl)ethyl 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)OCCn2c(-c3ccccc3)nc3ccccc32)c1 |
| InChI | InChI=1S/C24H22N2O4/c1-28-19-14-18(15-20(16-19)29-2)24(27)30-13-12-26-22-11-7-6-10-21(22)25-23(26)17-8-4-3-5-9-17/h3-11,14-16H,12-13H2,1-2H3 |
| InChIKey | BEQUIWRCKAMWOL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |