C23H30N6OS — CID 58974631
N-(3,5-dimethylphenyl)-4-[4-methyl-5-[(2-morpholin-4-ylethylamino)methyl]-1,3-thiazol-2-yl]pyrimidin-2-amine (PubChem CID 58974631) has the molecular formula C23H30N6OS and a molecular weight of 438.60 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-4-[4-methyl-5-[(2-morpholin-4-ylethylamino)methyl]-1,3-thiazol-2-yl]pyrimidin-2-amine.
| Compound Name | N-(3,5-dimethylphenyl)-4-[4-methyl-5-[(2-morpholin-4-ylethylamino)methyl]-1,3-thiazol-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 58974631 |
| Molecular Formula | C23H30N6OS |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | N-(3,5-dimethylphenyl)-4-[4-methyl-5-[(2-morpholin-4-ylethylamino)methyl]-1,3-thiazol-2-yl]pyrimidin-2-amine |
| SMILES | Cc1cc(C)cc(Nc2nccc(-c3nc(C)c(CNCCN4CCOCC4)s3)n2)c1 |
| InChI | InChI=1S/C23H30N6OS/c1-16-12-17(2)14-19(13-16)27-23-25-5-4-20(28-23)22-26-18(3)21(31-22)15-24-6-7-29-8-10-30-11-9-29/h4-5,12-14,24H,6-11,15H2,1-3H3,(H,25,27,28) |
| InChIKey | GUURIAORDOQRJX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 75.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|