C28H28BFN2O5S — CID 58975028
N-[(4-fluorophenyl)methyl]-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]sulfonylbenzamide (PubChem CID 58975028) has the molecular formula C28H28BFN2O5S and a molecular weight of 534.42 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]sulfonylbenzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 58975028 |
| Molecular Formula | C28H28BFN2O5S |
| Molecular Weight | 534.42 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]sulfonylbenzamide |
| SMILES | CC1(C)OB(c2cn(S(=O)(=O)c3ccc(C(=O)NCc4ccc(F)cc4)cc3)c3ccccc23)OC1(C)C |
| InChI | InChI=1S/C28H28BFN2O5S/c1-27(2)28(3,4)37-29(36-27)24-18-32(25-8-6-5-7-23(24)25)38(34,35)22-15-11-20(12-16-22)26(33)31-17-19-9-13-21(30)14-10-19/h5-16,18H,17H2,1-4H3,(H,31,33) |
| InChIKey | QUZUNVUQEJVTAH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|