C24H31N3O — CID 58975257
[3-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-2,2-diphenylpropyl]urea (PubChem CID 58975257) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is [3-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-2,2-diphenylpropyl]urea.
| Compound Name | [3-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-2,2-diphenylpropyl]urea |
|---|---|
| PubChem CID | 58975257 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | [3-[(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl]-2,2-diphenylpropyl]urea |
| SMILES | CN1[C@@H]2CC[C@H]1CC(CC(CNC(N)=O)(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C24H31N3O/c1-27-21-12-13-22(27)15-18(14-21)16-24(17-26-23(25)28,19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-11,18,21-22H,12-17H2,1H3,(H3,25,26,28)/t18?,21-,22+ |
| InChIKey | XVTZQTLXSLKPCP-CZAFVFSZSA-N |
| XLogP | 3.90 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |