C20H29NO5S — CID 58975287
S-(3-oxopentyl) 6-[cyclohex-2-en-1-yl(hydroxy)methyl]-6a-methyl-4-oxo-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrole-6-carbothioate (PubChem CID 58975287) has the molecular formula C20H29NO5S and a molecular weight of 395.52 g/mol. Its IUPAC name is S-(3-oxopentyl) 6-[cyclohex-2-en-1-yl(hydroxy)methyl]-6a-methyl-4-oxo-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrole-6-carbothioate.
| Compound Name | S-(3-oxopentyl) 6-[cyclohex-2-en-1-yl(hydroxy)methyl]-6a-methyl-4-oxo-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrole-6-carbothioate |
|---|---|
| PubChem CID | 58975287 |
| Molecular Formula | C20H29NO5S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | S-(3-oxopentyl) 6-[cyclohex-2-en-1-yl(hydroxy)methyl]-6a-methyl-4-oxo-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrole-6-carbothioate |
| SMILES | CCC(=O)CCSC(=O)C1(C(O)C2C=CCCC2)NC(=O)C2CCOC21C |
| InChI | InChI=1S/C20H29NO5S/c1-3-14(22)10-12-27-18(25)20(16(23)13-7-5-4-6-8-13)19(2)15(9-11-26-19)17(24)21-20/h5,7,13,15-16,23H,3-4,6,8-12H2,1-2H3,(H,21,24) |
| InChIKey | BLQMSWBXEGHILF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|