C15H22ClNO6 — CID 58975294
(1R,4R,5S)-4-(2-chloroethyl)-1-[(S)-[(1R)-2,3-dihydroxycyclohexyl]-hydroxymethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 58975294) has the molecular formula C15H22ClNO6 and a molecular weight of 347.80 g/mol. Its IUPAC name is (1R,4R,5S)-4-(2-chloroethyl)-1-[(S)-[(1R)-2,3-dihydroxycyclohexyl]-hydroxymethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | (1R,4R,5S)-4-(2-chloroethyl)-1-[(S)-[(1R)-2,3-dihydroxycyclohexyl]-hydroxymethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 58975294 |
| Molecular Formula | C15H22ClNO6 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | (1R,4R,5S)-4-(2-chloroethyl)-1-[(S)-[(1R)-2,3-dihydroxycyclohexyl]-hydroxymethyl]-5-methyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | C[C@@]12OC(=O)[C@]1([C@@H](O)[C@H]1CCCC(O)C1O)NC(=O)[C@@H]2CCCl |
| InChI | InChI=1S/C15H22ClNO6/c1-14-8(5-6-16)12(21)17-15(14,13(22)23-14)11(20)7-3-2-4-9(18)10(7)19/h7-11,18-20H,2-6H2,1H3,(H,17,21)/t7-,8-,9?,10?,11-,14-,15-/m0/s1 |
| InChIKey | SRBGOJWOQNONCT-GLEWZHBHSA-N |
| XLogP | -0.70 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|