About 2-bromo-4,7-dimethyl-1H-indene
2-bromo-4,7-dimethyl-1H-indene (PubChem CID 58975409) has the molecular formula C11H11Br
and a molecular weight of 223.11 g/mol. Its IUPAC name is 2-bromo-4,7-dimethyl-1H-indene.
Molecular Properties
| Compound Name | 2-bromo-4,7-dimethyl-1H-indene |
| PubChem CID | 58975409 |
| Molecular Formula | C11H11Br |
| Molecular Weight | 223.11 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 2-bromo-4,7-dimethyl-1H-indene |
| SMILES | Cc1ccc(C)c2c1C=C(Br)C2 |
| InChI | InChI=1S/C11H11Br/c1-7-3-4-8(2)11-6-9(12)5-10(7)11/h3-5H,6H2,1-2H3 |
| InChIKey | NFVXDEFZPQKUOU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.11 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-bromo-4,7-dimethyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4,7-dimethyl-1H-indene?
The IUPAC name of 2-bromo-4,7-dimethyl-1H-indene (CID 58975409) is 2-bromo-4,7-dimethyl-1H-indene.
What is the SMILES notation for 2-bromo-4,7-dimethyl-1H-indene?
The canonical SMILES for 2-bromo-4,7-dimethyl-1H-indene is Cc1ccc(C)c2c1C=C(Br)C2.
What is the InChIKey of 2-bromo-4,7-dimethyl-1H-indene?
The InChIKey is NFVXDEFZPQKUOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Br/c1-7-3-4-8(2)11-6-9(12)5-10(7)11/h3-5H,6H2,1-2H3.
What are the key properties of 2-bromo-4,7-dimethyl-1H-indene?
2-bromo-4,7-dimethyl-1H-indene has a molecular weight of 223.11 g/mol, XLogP of 3.60, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4,7-dimethyl-1H-indene is sourced from PubChem (CID 58975409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).