C15H27N — CID 58975412
1-(4,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl)pyrrolidine (PubChem CID 58975412) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 1-(4,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl)pyrrolidine.
| Compound Name | 1-(4,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 58975412 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 1-(4,7-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl)pyrrolidine |
| SMILES | CC1CCC(C)C2CC(N3CCCC3)CC12 |
| InChI | InChI=1S/C15H27N/c1-11-5-6-12(2)15-10-13(9-14(11)15)16-7-3-4-8-16/h11-15H,3-10H2,1-2H3 |
| InChIKey | PJMPCSWYGFNYEQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |