C16H7F5N2 — CID 58975830
5-(2,3,4,5,6-pentafluorophenyl)-2-pyridin-2-ylpyridine (PubChem CID 58975830) has the molecular formula C16H7F5N2 and a molecular weight of 322.24 g/mol. Its IUPAC name is 5-(2,3,4,5,6-pentafluorophenyl)-2-pyridin-2-ylpyridine.
| Compound Name | 5-(2,3,4,5,6-pentafluorophenyl)-2-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 58975830 |
| Molecular Formula | C16H7F5N2 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 5-(2,3,4,5,6-pentafluorophenyl)-2-pyridin-2-ylpyridine |
| SMILES | Fc1c(F)c(F)c(-c2ccc(-c3ccccn3)nc2)c(F)c1F |
| InChI | InChI=1S/C16H7F5N2/c17-12-11(13(18)15(20)16(21)14(12)19)8-4-5-10(23-7-8)9-3-1-2-6-22-9/h1-7H |
| InChIKey | FNELUMXJWCPDNP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|