About 1-(hydroxy-methylidene-oxo-λ6-sulfanyl)oxy-7,7-dimethylbicyclo[2.2.1]heptan-2-one
1-(hydroxy-methylidene-oxo-λ6-sulfanyl)oxy-7,7-dimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 58975844) has the molecular formula C10H16O4S
and a molecular weight of 232.30 g/mol. Its IUPAC name is 1-(hydroxy-methylidene-oxo-λ6-sulfanyl)oxy-7,7-dimethylbicyclo[2.2.1]heptan-2-one.
Molecular Properties
| Compound Name | 1-(hydroxy-methylidene-oxo-λ6-sulfanyl)oxy-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
| PubChem CID | 58975844 |
| Molecular Formula | C10H16O4S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 1-(hydroxy-methylidene-oxo-λ6-sulfanyl)oxy-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | C=S(=O)(O)OC12CCC(CC1=O)C2(C)C |
| InChI | InChI=1S/C10H16O4S/c1-9(2)7-4-5-10(9,8(11)6-7)14-15(3,12)13/h7H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | UXQCZRVZGKQIIL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(hydroxy-methylidene-oxo-λ6-sulfanyl)oxy-7,7-dimethylbicyclo[2.2.1]heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(hydroxy-methylidene-oxo-λ6-sulfanyl)oxy-7,7-dimethylbicyclo[2.2.1]heptan-2-one?
The IUPAC name of 1-(hydroxy-methylidene-oxo-λ6-sulfanyl)oxy-7,7-dimethylbicyclo[2.2.1]heptan-2-one (CID 58975844) is 1-(hydroxy-methylidene-oxo-λ6-sulfanyl)oxy-7,7-dimethylbicyclo[2.2.1]heptan-2-one.
What is the SMILES notation for 1-(hydroxy-methylidene-oxo-λ6-sulfanyl)oxy-7,7-dimethylbicyclo[2.2.1]heptan-2-one?
The canonical SMILES for 1-(hydroxy-methylidene-oxo-λ6-sulfanyl)oxy-7,7-dimethylbicyclo[2.2.1]heptan-2-one is C=S(=O)(O)OC12CCC(CC1=O)C2(C)C.
What is the InChIKey of 1-(hydroxy-methylidene-oxo-λ6-sulfanyl)oxy-7,7-dimethylbicyclo[2.2.1]heptan-2-one?
The InChIKey is UXQCZRVZGKQIIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4S/c1-9(2)7-4-5-10(9,8(11)6-7)14-15(3,12)13/h7H,3-6H2,1-2H3,(H,12,13).
What are the key properties of 1-(hydroxy-methylidene-oxo-λ6-sulfanyl)oxy-7,7-dimethylbicyclo[2.2.1]heptan-2-one?
1-(hydroxy-methylidene-oxo-λ6-sulfanyl)oxy-7,7-dimethylbicyclo[2.2.1]heptan-2-one has a molecular weight of 232.30 g/mol, XLogP of 1.26, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(hydroxy-methylidene-oxo-λ6-sulfanyl)oxy-7,7-dimethylbicyclo[2.2.1]heptan-2-one is sourced from PubChem (CID 58975844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).