About 2-[3-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]-1-adamantyl]acetic acid
2-[3-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]-1-adamantyl]acetic acid (PubChem CID 58975883) has the molecular formula C21H33NO5
and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-[3-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]-1-adamantyl]acetic acid.
Molecular Properties
| Compound Name | 2-[3-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]-1-adamantyl]acetic acid |
| PubChem CID | 58975883 |
| Molecular Formula | C21H33NO5 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 2-[3-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]-1-adamantyl]acetic acid |
| SMILES | CCC(C)(C)C(=O)OCCNC(=O)C12CC3CC(CC(CC(=O)O)(C3)C1)C2 |
| InChI | InChI=1S/C21H33NO5/c1-4-19(2,3)18(26)27-6-5-22-17(25)21-10-14-7-15(11-21)9-20(8-14,13-21)12-16(23)24/h14-15H,4-13H2,1-3H3,(H,22,25)(H,23,24) |
| InChIKey | ZJKJICDUSHRGMC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]-1-adamantyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]-1-adamantyl]acetic acid?
The IUPAC name of 2-[3-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]-1-adamantyl]acetic acid (CID 58975883) is 2-[3-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]-1-adamantyl]acetic acid.
What is the SMILES notation for 2-[3-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]-1-adamantyl]acetic acid?
The canonical SMILES for 2-[3-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]-1-adamantyl]acetic acid is CCC(C)(C)C(=O)OCCNC(=O)C12CC3CC(CC(CC(=O)O)(C3)C1)C2.
What is the InChIKey of 2-[3-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]-1-adamantyl]acetic acid?
The InChIKey is ZJKJICDUSHRGMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H33NO5/c1-4-19(2,3)18(26)27-6-5-22-17(25)21-10-14-7-15(11-21)9-20(8-14,13-21)12-16(23)24/h14-15H,4-13H2,1-3H3,(H,22,25)(H,23,24).
What are the key properties of 2-[3-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]-1-adamantyl]acetic acid?
2-[3-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]-1-adamantyl]acetic acid has a molecular weight of 379.50 g/mol, XLogP of 3.14, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]-1-adamantyl]acetic acid is sourced from PubChem (CID 58975883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).