About N-(3,6-dimethylcyclohexa-1,4-dien-1-yl)ethanimine;tungsten(2+)
N-(3,6-dimethylcyclohexa-1,4-dien-1-yl)ethanimine;tungsten(2+) (PubChem CID 58975923) has the molecular formula C10H13NW
and a molecular weight of 331.06 g/mol. Its IUPAC name is N-(3,6-dimethylcyclohexa-1,4-dien-1-yl)ethanimine;tungsten(2+).
Molecular Properties
| Compound Name | N-(3,6-dimethylcyclohexa-1,4-dien-1-yl)ethanimine;tungsten(2+) |
| PubChem CID | 58975923 |
| Molecular Formula | C10H13NW |
| Molecular Weight | 331.06 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-(3,6-dimethylcyclohexa-1,4-dien-1-yl)ethanimine;tungsten(2+) |
| SMILES | C/[C-]=N/C1=[C-]C(C)C=CC1C.[W+2] |
| InChI | InChI=1S/C10H13N.W/c1-4-11-10-7-8(2)5-6-9(10)3;/h5-6,8-9H,1-3H3;/q-2;+2 |
| InChIKey | JHYSZKBAESKTFG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.06 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(3,6-dimethylcyclohexa-1,4-dien-1-yl)ethanimine;tungsten(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,6-dimethylcyclohexa-1,4-dien-1-yl)ethanimine;tungsten(2+)?
The IUPAC name of N-(3,6-dimethylcyclohexa-1,4-dien-1-yl)ethanimine;tungsten(2+) (CID 58975923) is N-(3,6-dimethylcyclohexa-1,4-dien-1-yl)ethanimine;tungsten(2+).
What is the SMILES notation for N-(3,6-dimethylcyclohexa-1,4-dien-1-yl)ethanimine;tungsten(2+)?
The canonical SMILES for N-(3,6-dimethylcyclohexa-1,4-dien-1-yl)ethanimine;tungsten(2+) is C/[C-]=N/C1=[C-]C(C)C=CC1C.[W+2].
What is the InChIKey of N-(3,6-dimethylcyclohexa-1,4-dien-1-yl)ethanimine;tungsten(2+)?
The InChIKey is JHYSZKBAESKTFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N.W/c1-4-11-10-7-8(2)5-6-9(10)3;/h5-6,8-9H,1-3H3;/q-2;+2.
What are the key properties of N-(3,6-dimethylcyclohexa-1,4-dien-1-yl)ethanimine;tungsten(2+)?
N-(3,6-dimethylcyclohexa-1,4-dien-1-yl)ethanimine;tungsten(2+) has a molecular weight of 331.06 g/mol, XLogP of 2.48, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,6-dimethylcyclohexa-1,4-dien-1-yl)ethanimine;tungsten(2+) is sourced from PubChem (CID 58975923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).