C8H11N7 — CID 58976128
3-N-ethyl-1-pyrimidin-2-yl-1,2,4-triazole-3,5-diamine (PubChem CID 58976128) has the molecular formula C8H11N7 and a molecular weight of 205.23 g/mol. Its IUPAC name is 3-N-ethyl-1-pyrimidin-2-yl-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-ethyl-1-pyrimidin-2-yl-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 58976128 |
| Molecular Formula | C8H11N7 |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 3-N-ethyl-1-pyrimidin-2-yl-1,2,4-triazole-3,5-diamine |
| SMILES | CCNc1nc(N)n(-c2ncccn2)n1 |
| InChI | InChI=1S/C8H11N7/c1-2-10-7-13-6(9)15(14-7)8-11-4-3-5-12-8/h3-5H,2H2,1H3,(H3,9,10,13,14) |
| InChIKey | SZKRCJZBLRQPOK-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |