C19H24N6O4 — CID 58976253
3-N-[3,4-bis(2-methoxyethoxy)phenyl]-1-pyridin-2-yl-1,2,4-triazole-3,5-diamine (PubChem CID 58976253) has the molecular formula C19H24N6O4 and a molecular weight of 400.44 g/mol. Its IUPAC name is 3-N-[3,4-bis(2-methoxyethoxy)phenyl]-1-pyridin-2-yl-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[3,4-bis(2-methoxyethoxy)phenyl]-1-pyridin-2-yl-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 58976253 |
| Molecular Formula | C19H24N6O4 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 3-N-[3,4-bis(2-methoxyethoxy)phenyl]-1-pyridin-2-yl-1,2,4-triazole-3,5-diamine |
| SMILES | COCCOc1ccc(Nc2nc(N)n(-c3ccccn3)n2)cc1OCCOC |
| InChI | InChI=1S/C19H24N6O4/c1-26-9-11-28-15-7-6-14(13-16(15)29-12-10-27-2)22-19-23-18(20)25(24-19)17-5-3-4-8-21-17/h3-8,13H,9-12H2,1-2H3,(H3,20,22,23,24) |
| InChIKey | ULUOCJZYKACNCG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|