C20H23N8O2S2+ — CID 58976807
2-(1,3-benzothiazol-2-yl)-5-N-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]-1H-1,2,4-triazol-2-ium-3,5-diamine (PubChem CID 58976807) has the molecular formula C20H23N8O2S2+ and a molecular weight of 471.59 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-5-N-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]-1H-1,2,4-triazol-2-ium-3,5-diamine.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-5-N-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]-1H-1,2,4-triazol-2-ium-3,5-diamine |
|---|---|
| PubChem CID | 58976807 |
| Molecular Formula | C20H23N8O2S2+ |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-5-N-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]-1H-1,2,4-triazol-2-ium-3,5-diamine |
| SMILES | CN1CCN(S(=O)(=O)c2cccc(Nc3nc(N)[n+](-c4nc5ccccc5s4)[nH]3)c2)CC1 |
| InChI | InChI=1S/C20H22N8O2S2/c1-26-9-11-27(12-10-26)32(29,30)15-6-4-5-14(13-15)22-19-24-18(21)28(25-19)20-23-16-7-2-3-8-17(16)31-20/h2-8,13H,9-12H2,1H3,(H3,21,22,24,25)/p+1 |
| InChIKey | IJBIRPRRHJLQHS-UHFFFAOYSA-O |
| XLogP | 1.56 |
| TPSA | 124.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|