C23H29N9O2 — CID 58976849
[6-[5-amino-3-(4-morpholin-4-ylanilino)-1,2,4-triazol-1-yl]-3-pyridinyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 58976849) has the molecular formula C23H29N9O2 and a molecular weight of 463.55 g/mol. Its IUPAC name is [6-[5-amino-3-(4-morpholin-4-ylanilino)-1,2,4-triazol-1-yl]-3-pyridinyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [6-[5-amino-3-(4-morpholin-4-ylanilino)-1,2,4-triazol-1-yl]-3-pyridinyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 58976849 |
| Molecular Formula | C23H29N9O2 |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | [6-[5-amino-3-(4-morpholin-4-ylanilino)-1,2,4-triazol-1-yl]-3-pyridinyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccc(-n3nc(Nc4ccc(N5CCOCC5)cc4)nc3N)nc2)CC1 |
| InChI | InChI=1S/C23H29N9O2/c1-29-8-10-31(11-9-29)21(33)17-2-7-20(25-16-17)32-22(24)27-23(28-32)26-18-3-5-19(6-4-18)30-12-14-34-15-13-30/h2-7,16H,8-15H2,1H3,(H3,24,26,27,28) |
| InChIKey | ZEBODMCYNCZNAN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|