C14H9F6N3O — CID 58977212
1,1,1,3,3,3-hexafluoro-2-[4-(4-isocyano-1-methylpyrazol-3-yl)phenyl]propan-2-ol (PubChem CID 58977212) has the molecular formula C14H9F6N3O and a molecular weight of 349.23 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-(4-isocyano-1-methylpyrazol-3-yl)phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-(4-isocyano-1-methylpyrazol-3-yl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 58977212 |
| Molecular Formula | C14H9F6N3O |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-(4-isocyano-1-methylpyrazol-3-yl)phenyl]propan-2-ol |
| SMILES | [C-]#[N+]c1cn(C)nc1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H9F6N3O/c1-21-10-7-23(2)22-11(10)8-3-5-9(6-4-8)12(24,13(15,16)17)14(18,19)20/h3-7,24H,2H3 |
| InChIKey | CCBQNNJXRPLIQM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 42.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|