C20H21NO3 — CID 58977484
(1S,3aS,6aR)-5-benzyl-1-(4-hydroxyphenyl)-3a-methyl-1,4,6,6a-tetrahydrofuro[3,4-c]pyrrol-3-one (PubChem CID 58977484) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is (1S,3aS,6aR)-5-benzyl-1-(4-hydroxyphenyl)-3a-methyl-1,4,6,6a-tetrahydrofuro[3,4-c]pyrrol-3-one.
| Compound Name | (1S,3aS,6aR)-5-benzyl-1-(4-hydroxyphenyl)-3a-methyl-1,4,6,6a-tetrahydrofuro[3,4-c]pyrrol-3-one |
|---|---|
| PubChem CID | 58977484 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | (1S,3aS,6aR)-5-benzyl-1-(4-hydroxyphenyl)-3a-methyl-1,4,6,6a-tetrahydrofuro[3,4-c]pyrrol-3-one |
| SMILES | C[C@@]12CN(Cc3ccccc3)C[C@@H]1[C@@H](c1ccc(O)cc1)OC2=O |
| InChI | InChI=1S/C20H21NO3/c1-20-13-21(11-14-5-3-2-4-6-14)12-17(20)18(24-19(20)23)15-7-9-16(22)10-8-15/h2-10,17-18,22H,11-13H2,1H3/t17-,18-,20-/m1/s1 |
| InChIKey | DILTUDMQRRZZOJ-QWFCFKBJSA-N |
| XLogP | 3.13 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |