C20H24N4O — CID 58977552
2-[(3S,4R)-3-[[4-(2-isocyanoethoxy)phenyl]methyl]-4-methylpyrrolidin-1-yl]-4-methylpyrimidine (PubChem CID 58977552) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 2-[(3S,4R)-3-[[4-(2-isocyanoethoxy)phenyl]methyl]-4-methylpyrrolidin-1-yl]-4-methylpyrimidine.
| Compound Name | 2-[(3S,4R)-3-[[4-(2-isocyanoethoxy)phenyl]methyl]-4-methylpyrrolidin-1-yl]-4-methylpyrimidine |
|---|---|
| PubChem CID | 58977552 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-[(3S,4R)-3-[[4-(2-isocyanoethoxy)phenyl]methyl]-4-methylpyrrolidin-1-yl]-4-methylpyrimidine |
| SMILES | [C-]#[N+]CCOc1ccc(C[C@@H]2CN(c3nccc(C)n3)C[C@@H]2C)cc1 |
| InChI | InChI=1S/C20H24N4O/c1-15-13-24(20-22-9-8-16(2)23-20)14-18(15)12-17-4-6-19(7-5-17)25-11-10-21-3/h4-9,15,18H,10-14H2,1-2H3/t15-,18+/m0/s1 |
| InChIKey | VNWYXRZPCZQHKT-MAUKXSAKSA-N |
| XLogP | 3.40 |
| TPSA | 42.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|