About benzyl N-[3,5-difluoro-4-[(E)-3-hydroxyprop-1-enyl]phenyl]carbamate
benzyl N-[3,5-difluoro-4-[(E)-3-hydroxyprop-1-enyl]phenyl]carbamate (PubChem CID 58978109) has the molecular formula C17H15F2NO3
and a molecular weight of 319.31 g/mol. Its IUPAC name is benzyl N-[3,5-difluoro-4-[(E)-3-hydroxyprop-1-enyl]phenyl]carbamate.
Molecular Properties
| Compound Name | benzyl N-[3,5-difluoro-4-[(E)-3-hydroxyprop-1-enyl]phenyl]carbamate |
| PubChem CID | 58978109 |
| Molecular Formula | C17H15F2NO3 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | benzyl N-[3,5-difluoro-4-[(E)-3-hydroxyprop-1-enyl]phenyl]carbamate |
| SMILES | O=C(Nc1cc(F)c(/C=C/CO)c(F)c1)OCc1ccccc1 |
| InChI | InChI=1S/C17H15F2NO3/c18-15-9-13(10-16(19)14(15)7-4-8-21)20-17(22)23-11-12-5-2-1-3-6-12/h1-7,9-10,21H,8,11H2,(H,20,22)/b7-4+ |
| InChIKey | DTTPCGDIFIVPTF-QPJJXVBHSA-N |
| XLogP | 3.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzyl N-[3,5-difluoro-4-[(E)-3-hydroxyprop-1-enyl]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-[3,5-difluoro-4-[(E)-3-hydroxyprop-1-enyl]phenyl]carbamate?
The IUPAC name of benzyl N-[3,5-difluoro-4-[(E)-3-hydroxyprop-1-enyl]phenyl]carbamate (CID 58978109) is benzyl N-[3,5-difluoro-4-[(E)-3-hydroxyprop-1-enyl]phenyl]carbamate.
What is the SMILES notation for benzyl N-[3,5-difluoro-4-[(E)-3-hydroxyprop-1-enyl]phenyl]carbamate?
The canonical SMILES for benzyl N-[3,5-difluoro-4-[(E)-3-hydroxyprop-1-enyl]phenyl]carbamate is O=C(Nc1cc(F)c(/C=C/CO)c(F)c1)OCc1ccccc1.
What is the InChIKey of benzyl N-[3,5-difluoro-4-[(E)-3-hydroxyprop-1-enyl]phenyl]carbamate?
The InChIKey is DTTPCGDIFIVPTF-QPJJXVBHSA-N. The full InChI is InChI=1S/C17H15F2NO3/c18-15-9-13(10-16(19)14(15)7-4-8-21)20-17(22)23-11-12-5-2-1-3-6-12/h1-7,9-10,21H,8,11H2,(H,20,22)/b7-4+.
What are the key properties of benzyl N-[3,5-difluoro-4-[(E)-3-hydroxyprop-1-enyl]phenyl]carbamate?
benzyl N-[3,5-difluoro-4-[(E)-3-hydroxyprop-1-enyl]phenyl]carbamate has a molecular weight of 319.31 g/mol, XLogP of 3.72, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-[3,5-difluoro-4-[(E)-3-hydroxyprop-1-enyl]phenyl]carbamate is sourced from PubChem (CID 58978109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).