C16H21N5 — CID 58978477
N,N-dimethyl-2-[2-methyl-5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]ethanamine (PubChem CID 58978477) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is N,N-dimethyl-2-[2-methyl-5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]ethanamine.
| Compound Name | N,N-dimethyl-2-[2-methyl-5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]ethanamine |
|---|---|
| PubChem CID | 58978477 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | N,N-dimethyl-2-[2-methyl-5-(1,2,4-triazol-1-ylmethyl)-1H-indol-3-yl]ethanamine |
| SMILES | Cc1[nH]c2ccc(Cn3cncn3)cc2c1CCN(C)C |
| InChI | InChI=1S/C16H21N5/c1-12-14(6-7-20(2)3)15-8-13(4-5-16(15)19-12)9-21-11-17-10-18-21/h4-5,8,10-11,19H,6-7,9H2,1-3H3 |
| InChIKey | KWLYJQZJNSJGDF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|