C10H17F3N2O14P3- — CID 58978844
[hydroxy-[[3-hydroxy-5-[2-[(2,2,2-trifluoroacetyl)amino]ethylcarbamoyl]oxolan-2-yl]methoxyperoxy]phosphoryl]-[hydroxy(trioxidanyl)phosphoryl]phosphanide (PubChem CID 58978844) has the molecular formula C10H17F3N2O14P3- and a molecular weight of 539.16 g/mol. Its IUPAC name is [hydroxy-[[3-hydroxy-5-[2-[(2,2,2-trifluoroacetyl)amino]ethylcarbamoyl]oxolan-2-yl]methoxyperoxy]phosphoryl]-[hydroxy(trioxidanyl)phosphoryl]phosphanide.
| Compound Name | [hydroxy-[[3-hydroxy-5-[2-[(2,2,2-trifluoroacetyl)amino]ethylcarbamoyl]oxolan-2-yl]methoxyperoxy]phosphoryl]-[hydroxy(trioxidanyl)phosphoryl]phosphanide |
|---|---|
| PubChem CID | 58978844 |
| Molecular Formula | C10H17F3N2O14P3- |
| Molecular Weight | 539.16 g/mol |
| Exact Mass | 538.99 |
| IUPAC Name | [hydroxy-[[3-hydroxy-5-[2-[(2,2,2-trifluoroacetyl)amino]ethylcarbamoyl]oxolan-2-yl]methoxyperoxy]phosphoryl]-[hydroxy(trioxidanyl)phosphoryl]phosphanide |
| SMILES | O=C(NCCNC(=O)C(F)(F)F)C1CC(O)C(COOOP(=O)(O)[P-]P(=O)(O)OOO)O1 |
| InChI | InChI=1S/C10H17F3N2O14P3/c11-10(12,13)9(18)15-2-1-14-8(17)6-3-5(16)7(25-6)4-24-27-29-32(22,23)30-31(20,21)28-26-19/h5-7,16,19H,1-4H2,(H,14,17)(H,15,18)(H,20,21)(H,22,23)/q-1 |
| InChIKey | HBRGNPCQIZDUHD-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 228.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.16 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|