C11H17F3N2O4 — CID 58978847
5-ethyl-4-hydroxy-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]oxolane-2-carboxamide (PubChem CID 58978847) has the molecular formula C11H17F3N2O4 and a molecular weight of 298.26 g/mol. Its IUPAC name is 5-ethyl-4-hydroxy-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]oxolane-2-carboxamide.
| Compound Name | 5-ethyl-4-hydroxy-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 58978847 |
| Molecular Formula | C11H17F3N2O4 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 5-ethyl-4-hydroxy-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]oxolane-2-carboxamide |
| SMILES | CCC1OC(C(=O)NCCNC(=O)C(F)(F)F)CC1O |
| InChI | InChI=1S/C11H17F3N2O4/c1-2-7-6(17)5-8(20-7)9(18)15-3-4-16-10(19)11(12,13)14/h6-8,17H,2-5H2,1H3,(H,15,18)(H,16,19) |
| InChIKey | DDHREYHPEFQGSL-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|