About 8-bromo-1,6-naphthyridin-2-amine
8-bromo-1,6-naphthyridin-2-amine (PubChem CID 58979582) has the molecular formula C8H6BrN3
and a molecular weight of 224.06 g/mol. Its IUPAC name is 8-bromo-1,6-naphthyridin-2-amine.
Molecular Properties
| Compound Name | 8-bromo-1,6-naphthyridin-2-amine |
| PubChem CID | 58979582 |
| Molecular Formula | C8H6BrN3 |
| Molecular Weight | 224.06 g/mol |
| Exact Mass | 222.97 |
| IUPAC Name | 8-bromo-1,6-naphthyridin-2-amine |
| SMILES | Nc1ccc2cncc(Br)c2n1 |
| InChI | InChI=1S/C8H6BrN3/c9-6-4-11-3-5-1-2-7(10)12-8(5)6/h1-4H,(H2,10,12) |
| InChIKey | DSKYYPPTFGPHDE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.06 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-bromo-1,6-naphthyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-1,6-naphthyridin-2-amine?
The IUPAC name of 8-bromo-1,6-naphthyridin-2-amine (CID 58979582) is 8-bromo-1,6-naphthyridin-2-amine.
What is the SMILES notation for 8-bromo-1,6-naphthyridin-2-amine?
The canonical SMILES for 8-bromo-1,6-naphthyridin-2-amine is Nc1ccc2cncc(Br)c2n1.
What is the InChIKey of 8-bromo-1,6-naphthyridin-2-amine?
The InChIKey is DSKYYPPTFGPHDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrN3/c9-6-4-11-3-5-1-2-7(10)12-8(5)6/h1-4H,(H2,10,12).
What are the key properties of 8-bromo-1,6-naphthyridin-2-amine?
8-bromo-1,6-naphthyridin-2-amine has a molecular weight of 224.06 g/mol, XLogP of 1.97, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-1,6-naphthyridin-2-amine is sourced from PubChem (CID 58979582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).